C16H34NOP — CID 10803227
2,2,3,4,4-pentamethyl-N-octyl-1-oxo-1λ5-phosphetan-1-amine (PubChem CID 10803227) has the molecular formula C16H34NOP and a molecular weight of 287.43 g/mol. Its IUPAC name is 2,2,3,4,4-pentamethyl-N-octyl-1-oxo-1λ5-phosphetan-1-amine.
| Compound Name | 2,2,3,4,4-pentamethyl-N-octyl-1-oxo-1λ5-phosphetan-1-amine |
|---|---|
| PubChem CID | 10803227 |
| Molecular Formula | C16H34NOP |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 2,2,3,4,4-pentamethyl-N-octyl-1-oxo-1λ5-phosphetan-1-amine |
| SMILES | CCCCCCCCNP1(=O)C(C)(C)C(C)C1(C)C |
| InChI | InChI=1S/C16H34NOP/c1-7-8-9-10-11-12-13-17-19(18)15(3,4)14(2)16(19,5)6/h14H,7-13H2,1-6H3,(H,17,18) |
| InChIKey | RETZKFPRSXPFFF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|