About trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol
trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol (PubChem CID 10803430) has the molecular formula C14H27O4P
and a molecular weight of 290.34 g/mol. Its IUPAC name is trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol |
| PubChem CID | 10803430 |
| Molecular Formula | C14H27O4P |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol |
| SMILES | C=CC(C)[C@@]1(O)CCCC[C@@H]1P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H27O4P/c1-5-12(4)14(15)11-9-8-10-13(14)19(16,17-6-2)18-7-3/h5,12-13,15H,1,6-11H2,2-4H3/t12?,13-,14-/m0/s1 |
| InChIKey | MGJTUDNDUQZVID-TTZKSVMKSA-N |
| XLogP | 3.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol?
The IUPAC name of trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol (CID 10803430) is trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol.
What is the SMILES notation for trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol?
The canonical SMILES for trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol is C=CC(C)[C@@]1(O)CCCC[C@@H]1P(=O)(OCC)OCC.
What is the InChIKey of trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol?
The InChIKey is MGJTUDNDUQZVID-TTZKSVMKSA-N. The full InChI is InChI=1S/C14H27O4P/c1-5-12(4)14(15)11-9-8-10-13(14)19(16,17-6-2)18-7-3/h5,12-13,15H,1,6-11H2,2-4H3/t12?,13-,14-/m0/s1.
What are the key properties of trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol?
trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol has a molecular weight of 290.34 g/mol, XLogP of 3.75, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-1-but-3-en-2-yl-2-diethoxyphosphorylcyclohexan-1-ol is sourced from PubChem (CID 10803430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).