C16H22N2OS — CID 10803460
(S)-N-[(1R)-1-cyano-1-cyclohexylethyl]-4-methylbenzenesulfinamide (PubChem CID 10803460) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is (S)-N-[(1R)-1-cyano-1-cyclohexylethyl]-4-methylbenzenesulfinamide.
| Compound Name | (S)-N-[(1R)-1-cyano-1-cyclohexylethyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 10803460 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (S)-N-[(1R)-1-cyano-1-cyclohexylethyl]-4-methylbenzenesulfinamide |
| SMILES | Cc1ccc([S@](=O)N[C@@](C)(C#N)C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H22N2OS/c1-13-8-10-15(11-9-13)20(19)18-16(2,12-17)14-6-4-3-5-7-14/h8-11,14,18H,3-7H2,1-2H3/t16-,20-/m0/s1 |
| InChIKey | KPYJODWPEMKIAR-JXFKEZNVSA-N |
| XLogP | 3.47 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |