About (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine
(E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine (PubChem CID 10803535) has the molecular formula C17H22ClNO
and a molecular weight of 291.82 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine.
Molecular Properties
| Compound Name | (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine |
| PubChem CID | 10803535 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine |
| SMILES | CC(C)=CCC/C(C)=C/CO/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClNO/c1-14(2)5-4-6-15(3)11-12-20-19-13-16-7-9-17(18)10-8-16/h5,7-11,13H,4,6,12H2,1-3H3/b15-11+,19-13+ |
| InChIKey | SQSAJJYJHGVXRV-MFVIGFRPSA-N |
| XLogP | 5.38 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine?
The IUPAC name of (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine (CID 10803535) is (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine.
What is the SMILES notation for (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine?
The canonical SMILES for (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine is CC(C)=CCC/C(C)=C/CO/N=C/c1ccc(Cl)cc1.
What is the InChIKey of (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine?
The InChIKey is SQSAJJYJHGVXRV-MFVIGFRPSA-N. The full InChI is InChI=1S/C17H22ClNO/c1-14(2)5-4-6-15(3)11-12-20-19-13-16-7-9-17(18)10-8-16/h5,7-11,13H,4,6,12H2,1-3H3/b15-11+,19-13+.
What are the key properties of (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine?
(E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine has a molecular weight of 291.82 g/mol, XLogP of 5.38, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(4-chlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]methanimine is sourced from PubChem (CID 10803535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).