About 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one
4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one (PubChem CID 10803616) has the molecular formula C18H32OSi
and a molecular weight of 292.54 g/mol. Its IUPAC name is 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one.
Molecular Properties
| Compound Name | 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one |
| PubChem CID | 10803616 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one |
| SMILES | CCCCC1=C([Si](C)(C)C)C(=O)C(CCC)=C1CCC |
| InChI | InChI=1S/C18H32OSi/c1-7-10-13-16-14(11-8-2)15(12-9-3)17(19)18(16)20(4,5)6/h7-13H2,1-6H3 |
| InChIKey | FHHSGNJJRMABCF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one?
The IUPAC name of 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one (CID 10803616) is 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one.
What is the SMILES notation for 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one?
The canonical SMILES for 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one is CCCCC1=C([Si](C)(C)C)C(=O)C(CCC)=C1CCC.
What is the InChIKey of 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one?
The InChIKey is FHHSGNJJRMABCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32OSi/c1-7-10-13-16-14(11-8-2)15(12-9-3)17(19)18(16)20(4,5)6/h7-13H2,1-6H3.
What are the key properties of 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one?
4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one has a molecular weight of 292.54 g/mol, XLogP of 5.83, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2,3-dipropyl-5-trimethylsilylcyclopenta-2,4-dien-1-one is sourced from PubChem (CID 10803616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).