About methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate
methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate (PubChem CID 10803877) has the molecular formula C14H16O5S
and a molecular weight of 296.34 g/mol. Its IUPAC name is methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate.
Molecular Properties
| Compound Name | methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate |
| PubChem CID | 10803877 |
| Molecular Formula | C14H16O5S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate |
| SMILES | COC(=O)CC(=O)CC(=O)C[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16O5S/c1-10-3-5-13(6-4-10)20(18)9-12(16)7-11(15)8-14(17)19-2/h3-6H,7-9H2,1-2H3/t20-/m1/s1 |
| InChIKey | HODYVBIMPMDEGT-HXUWFJFHSA-N |
| XLogP | 1.19 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate?
The IUPAC name of methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate (CID 10803877) is methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate.
What is the SMILES notation for methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate?
The canonical SMILES for methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate is COC(=O)CC(=O)CC(=O)C[S@@](=O)c1ccc(C)cc1.
What is the InChIKey of methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate?
The InChIKey is HODYVBIMPMDEGT-HXUWFJFHSA-N. The full InChI is InChI=1S/C14H16O5S/c1-10-3-5-13(6-4-10)20(18)9-12(16)7-11(15)8-14(17)19-2/h3-6H,7-9H2,1-2H3/t20-/m1/s1.
What are the key properties of methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate?
methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate has a molecular weight of 296.34 g/mol, XLogP of 1.19, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(R)-(4-methylphenyl)sulfinyl]-3,5-dioxohexanoate is sourced from PubChem (CID 10803877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).