C14H12F3NO3 — CID 10804075
5,5-dimethyl-9-(trifluoromethyl)-6,10b-dihydro-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione (PubChem CID 10804075) has the molecular formula C14H12F3NO3 and a molecular weight of 299.25 g/mol. Its IUPAC name is 5,5-dimethyl-9-(trifluoromethyl)-6,10b-dihydro-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione.
| Compound Name | 5,5-dimethyl-9-(trifluoromethyl)-6,10b-dihydro-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione |
|---|---|
| PubChem CID | 10804075 |
| Molecular Formula | C14H12F3NO3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 5,5-dimethyl-9-(trifluoromethyl)-6,10b-dihydro-[1,3]oxazolo[2,3-a]isoquinoline-2,3-dione |
| SMILES | CC1(C)Cc2ccc(C(F)(F)F)cc2C2OC(=O)C(=O)N21 |
| InChI | InChI=1S/C14H12F3NO3/c1-13(2)6-7-3-4-8(14(15,16)17)5-9(7)11-18(13)10(19)12(20)21-11/h3-5,11H,6H2,1-2H3 |
| InChIKey | NHCFYMKHRUYQMW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|