About 1-pentylphenoxathiine 10,10-dioxide
1-pentylphenoxathiine 10,10-dioxide (PubChem CID 10804329) has the molecular formula C17H18O3S
and a molecular weight of 302.39 g/mol. Its IUPAC name is 1-pentylphenoxathiine 10,10-dioxide.
Molecular Properties
| Compound Name | 1-pentylphenoxathiine 10,10-dioxide |
| PubChem CID | 10804329 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-pentylphenoxathiine 10,10-dioxide |
| SMILES | CCCCCc1cccc2c1S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C17H18O3S/c1-2-3-4-8-13-9-7-11-15-17(13)21(18,19)16-12-6-5-10-14(16)20-15/h5-7,9-12H,2-4,8H2,1H3 |
| InChIKey | UKZXOQZSXGVIQX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylphenoxathiine 10,10-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylphenoxathiine 10,10-dioxide?
The IUPAC name of 1-pentylphenoxathiine 10,10-dioxide (CID 10804329) is 1-pentylphenoxathiine 10,10-dioxide.
What is the SMILES notation for 1-pentylphenoxathiine 10,10-dioxide?
The canonical SMILES for 1-pentylphenoxathiine 10,10-dioxide is CCCCCc1cccc2c1S(=O)(=O)c1ccccc1O2.
What is the InChIKey of 1-pentylphenoxathiine 10,10-dioxide?
The InChIKey is UKZXOQZSXGVIQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3S/c1-2-3-4-8-13-9-7-11-15-17(13)21(18,19)16-12-6-5-10-14(16)20-15/h5-7,9-12H,2-4,8H2,1H3.
What are the key properties of 1-pentylphenoxathiine 10,10-dioxide?
1-pentylphenoxathiine 10,10-dioxide has a molecular weight of 302.39 g/mol, XLogP of 4.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylphenoxathiine 10,10-dioxide is sourced from PubChem (CID 10804329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).