C19H26O3 — CID 10804337
(1R,2S,11R)-2-hydroxy-5-methoxy-6,12,12-trimethyltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one (PubChem CID 10804337) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (1R,2S,11R)-2-hydroxy-5-methoxy-6,12,12-trimethyltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one.
| Compound Name | (1R,2S,11R)-2-hydroxy-5-methoxy-6,12,12-trimethyltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one |
|---|---|
| PubChem CID | 10804337 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (1R,2S,11R)-2-hydroxy-5-methoxy-6,12,12-trimethyltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one |
| SMILES | COc1cc2c(cc1C)C(=O)C[C@@H]1[C@@H](CCCC1(C)C)[C@@H]2O |
| InChI | InChI=1S/C19H26O3/c1-11-8-13-14(9-17(11)22-4)18(21)12-6-5-7-19(2,3)15(12)10-16(13)20/h8-9,12,15,18,21H,5-7,10H2,1-4H3/t12-,15-,18+/m1/s1 |
| InChIKey | YWOWWOXOUJQJPE-DWQUBVKVSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |