C17H35FOSi — CID 10804359
fluoro-dimethyl-[(1S)-1-[(4S)-non-1-en-4-yl]oxyhexyl]silane (PubChem CID 10804359) has the molecular formula C17H35FOSi and a molecular weight of 302.55 g/mol. Its IUPAC name is fluoro-dimethyl-[(1S)-1-[(4S)-non-1-en-4-yl]oxyhexyl]silane.
| Compound Name | fluoro-dimethyl-[(1S)-1-[(4S)-non-1-en-4-yl]oxyhexyl]silane |
|---|---|
| PubChem CID | 10804359 |
| Molecular Formula | C17H35FOSi |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | fluoro-dimethyl-[(1S)-1-[(4S)-non-1-en-4-yl]oxyhexyl]silane |
| SMILES | C=CC[C@H](CCCCC)O[C@H](CCCCC)[Si](C)(C)F |
| InChI | InChI=1S/C17H35FOSi/c1-6-9-11-14-16(13-8-3)19-17(20(4,5)18)15-12-10-7-2/h8,16-17H,3,6-7,9-15H2,1-2,4-5H3/t16-,17+/m1/s1 |
| InChIKey | QRHSTOGJILBHKQ-SJORKVTESA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|