C17H25N3O2 — CID 10804408
2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-3-methyl-6-nitroaniline (PubChem CID 10804408) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-3-methyl-6-nitroaniline.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-3-methyl-6-nitroaniline |
|---|---|
| PubChem CID | 10804408 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-3-methyl-6-nitroaniline |
| SMILES | Cc1ccc([N+](=O)[O-])c(N)c1CN1CCCC2CCCCC21 |
| InChI | InChI=1S/C17H25N3O2/c1-12-8-9-16(20(21)22)17(18)14(12)11-19-10-4-6-13-5-2-3-7-15(13)19/h8-9,13,15H,2-7,10-11,18H2,1H3 |
| InChIKey | ARAVWNJSXCYVIC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|