C17H20O5 — CID 10804452
[(3aS,5R,5aR)-1,5,8-trimethyl-2,7-dioxo-4,5a,6,9-tetrahydro-3aH-azuleno[6,7-b]furan-5-yl] acetate (PubChem CID 10804452) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is [(3aS,5R,5aR)-1,5,8-trimethyl-2,7-dioxo-4,5a,6,9-tetrahydro-3aH-azuleno[6,7-b]furan-5-yl] acetate.
| Compound Name | [(3aS,5R,5aR)-1,5,8-trimethyl-2,7-dioxo-4,5a,6,9-tetrahydro-3aH-azuleno[6,7-b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 10804452 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [(3aS,5R,5aR)-1,5,8-trimethyl-2,7-dioxo-4,5a,6,9-tetrahydro-3aH-azuleno[6,7-b]furan-5-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)C[C@@H]2OC(=O)C(C)=C2CC2=C(C)C(=O)C[C@H]21 |
| InChI | InChI=1S/C17H20O5/c1-8-11-5-12-9(2)16(20)21-15(12)7-17(4,22-10(3)18)13(11)6-14(8)19/h13,15H,5-7H2,1-4H3/t13-,15+,17-/m1/s1 |
| InChIKey | JWWRQELEORKGCO-UKPHBRMFSA-N |
| XLogP | 2.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |