C19H33NO2 — CID 10804684
(4aR,8aR)-2-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-1,3,4,4a,5,8-hexahydroisoquinolin-8a-ol (PubChem CID 10804684) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is (4aR,8aR)-2-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-1,3,4,4a,5,8-hexahydroisoquinolin-8a-ol.
| Compound Name | (4aR,8aR)-2-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-1,3,4,4a,5,8-hexahydroisoquinolin-8a-ol |
|---|---|
| PubChem CID | 10804684 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | (4aR,8aR)-2-[2-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]propan-2-yl]-1,3,4,4a,5,8-hexahydroisoquinolin-8a-ol |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)N2CC[C@H]3CC=CC[C@]3(O)C2)[C@H](O)C1 |
| InChI | InChI=1S/C19H33NO2/c1-14-7-8-16(17(21)12-14)18(2,3)20-11-9-15-6-4-5-10-19(15,22)13-20/h4-5,14-17,21-22H,6-13H2,1-3H3/t14-,15-,16-,17-,19+/m1/s1 |
| InChIKey | HVEJGGRUROWFOK-VDCDIQELSA-N |
| XLogP | 2.97 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|