C16H8N2OS2 — CID 10804749
4,8-dithia-11,14-diazapentacyclo[10.8.0.02,9.03,7.013,18]icosa-1(12),2(9),3(7),5,13(18),14,16,19-octaen-10-one (PubChem CID 10804749) has the molecular formula C16H8N2OS2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 4,8-dithia-11,14-diazapentacyclo[10.8.0.02,9.03,7.013,18]icosa-1(12),2(9),3(7),5,13(18),14,16,19-octaen-10-one.
| Compound Name | 4,8-dithia-11,14-diazapentacyclo[10.8.0.02,9.03,7.013,18]icosa-1(12),2(9),3(7),5,13(18),14,16,19-octaen-10-one |
|---|---|
| PubChem CID | 10804749 |
| Molecular Formula | C16H8N2OS2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 4,8-dithia-11,14-diazapentacyclo[10.8.0.02,9.03,7.013,18]icosa-1(12),2(9),3(7),5,13(18),14,16,19-octaen-10-one |
| SMILES | O=c1[nH]c2c(ccc3cccnc32)c2c1sc1ccsc12 |
| InChI | InChI=1S/C16H8N2OS2/c19-16-15-11(14-10(21-15)5-7-20-14)9-4-3-8-2-1-6-17-12(8)13(9)18-16/h1-7H,(H,18,19) |
| InChIKey | CWGIQDJLZXJJKX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|