C15H22N2O3S — CID 10804912
(4E)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-hydroxyimino-3-thiophen-2-ylpentan-1-one (PubChem CID 10804912) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is (4E)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-hydroxyimino-3-thiophen-2-ylpentan-1-one.
| Compound Name | (4E)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-hydroxyimino-3-thiophen-2-ylpentan-1-one |
|---|---|
| PubChem CID | 10804912 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (4E)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-hydroxyimino-3-thiophen-2-ylpentan-1-one |
| SMILES | C/C(=N\O)C(CC(=O)N1C[C@@H](C)O[C@H](C)C1)c1cccs1 |
| InChI | InChI=1S/C15H22N2O3S/c1-10-8-17(9-11(2)20-10)15(18)7-13(12(3)16-19)14-5-4-6-21-14/h4-6,10-11,13,19H,7-9H2,1-3H3/b16-12+/t10-,11-,13?/m1/s1 |
| InChIKey | MVLNXYHFLFWVHR-FPELCWDGSA-N |
| XLogP | 2.71 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|