About tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate
tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate (PubChem CID 10805066) has the molecular formula C15H24N2O5
and a molecular weight of 312.37 g/mol. Its IUPAC name is tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate |
| PubChem CID | 10805066 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate |
| SMILES | CCOC(=O)CN1C/C=C\CN(C(=O)OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C15H24N2O5/c1-5-21-13(19)11-16-8-6-7-9-17(10-12(16)18)14(20)22-15(2,3)4/h6-7H,5,8-11H2,1-4H3/b7-6- |
| InChIKey | MBNPFUQHNHTKDJ-SREVYHEPSA-N |
| XLogP | 1.18 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate?
The IUPAC name of tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate (CID 10805066) is tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate.
What is the SMILES notation for tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate?
The canonical SMILES for tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate is CCOC(=O)CN1C/C=C\CN(C(=O)OC(C)(C)C)CC1=O.
What is the InChIKey of tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate?
The InChIKey is MBNPFUQHNHTKDJ-SREVYHEPSA-N. The full InChI is InChI=1S/C15H24N2O5/c1-5-21-13(19)11-16-8-6-7-9-17(10-12(16)18)14(20)22-15(2,3)4/h6-7H,5,8-11H2,1-4H3/b7-6-.
What are the key properties of tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate?
tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate has a molecular weight of 312.37 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (6Z)-4-(2-ethoxy-2-oxoethyl)-3-oxo-5,8-dihydro-2H-1,4-diazocine-1-carboxylate is sourced from PubChem (CID 10805066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).