About 1-benzyl-2,3-dihydroindole
1-benzyl-2,3-dihydroindole (PubChem CID 10805096) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-benzyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-benzyl-2,3-dihydroindole |
| PubChem CID | 10805096 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-benzyl-2,3-dihydroindole |
| SMILES | c1ccc(CN2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C15H15N/c1-2-6-13(7-3-1)12-16-11-10-14-8-4-5-9-15(14)16/h1-9H,10-12H2 |
| InChIKey | SBWJGPICKZXXOG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,3-dihydroindole?
The IUPAC name of 1-benzyl-2,3-dihydroindole (CID 10805096) is 1-benzyl-2,3-dihydroindole.
What is the SMILES notation for 1-benzyl-2,3-dihydroindole?
The canonical SMILES for 1-benzyl-2,3-dihydroindole is c1ccc(CN2CCc3ccccc32)cc1.
What is the InChIKey of 1-benzyl-2,3-dihydroindole?
The InChIKey is SBWJGPICKZXXOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-2-6-13(7-3-1)12-16-11-10-14-8-4-5-9-15(14)16/h1-9H,10-12H2.
What are the key properties of 1-benzyl-2,3-dihydroindole?
1-benzyl-2,3-dihydroindole has a molecular weight of 209.29 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,3-dihydroindole is sourced from PubChem (CID 10805096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).