About 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol
5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol (PubChem CID 10805108) has the molecular formula C18H17ClN2O
and a molecular weight of 312.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol |
| PubChem CID | 10805108 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol |
| SMILES | CC1(C)CN2C(=N1)c1ccccc1C2(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClN2O/c1-17(2)11-21-16(20-17)14-5-3-4-6-15(14)18(21,22)12-7-9-13(19)10-8-12/h3-10,22H,11H2,1-2H3 |
| InChIKey | XEUNLTQABDZKBW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol?
The IUPAC name of 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol (CID 10805108) is 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol.
What is the SMILES notation for 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol?
The canonical SMILES for 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol is CC1(C)CN2C(=N1)c1ccccc1C2(O)c1ccc(Cl)cc1.
What is the InChIKey of 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol?
The InChIKey is XEUNLTQABDZKBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2O/c1-17(2)11-21-16(20-17)14-5-3-4-6-15(14)18(21,22)12-7-9-13(19)10-8-12/h3-10,22H,11H2,1-2H3.
What are the key properties of 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol?
5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol has a molecular weight of 312.80 g/mol, XLogP of 3.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2,2-dimethyl-3H-imidazo[1,2-b]isoindol-5-ol is sourced from PubChem (CID 10805108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).