C18H25N3O2 — CID 10805300
(10S,13S)-13-(hydroxymethyl)-7,9-dimethyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one (PubChem CID 10805300) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (10S,13S)-13-(hydroxymethyl)-7,9-dimethyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one.
| Compound Name | (10S,13S)-13-(hydroxymethyl)-7,9-dimethyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one |
|---|---|
| PubChem CID | 10805300 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (10S,13S)-13-(hydroxymethyl)-7,9-dimethyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-1,4(15),5,7-tetraen-11-one |
| SMILES | Cc1ccc2[nH]cc3c2c1N(C)[C@@H](C(C)C)C(=O)N[C@H](CO)C3 |
| InChI | InChI=1S/C18H25N3O2/c1-10(2)16-18(23)20-13(9-22)7-12-8-19-14-6-5-11(3)17(15(12)14)21(16)4/h5-6,8,10,13,16,19,22H,7,9H2,1-4H3,(H,20,23)/t13-,16-/m0/s1 |
| InChIKey | HJKLPPNRFXMCTL-BBRMVZONSA-N |
| XLogP | 1.97 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |