C11H13N2O7P — CID 10805328
N-[2-(4-nitrophenoxy)-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl]acetamide (PubChem CID 10805328) has the molecular formula C11H13N2O7P and a molecular weight of 316.21 g/mol. Its IUPAC name is N-[2-(4-nitrophenoxy)-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl]acetamide.
| Compound Name | N-[2-(4-nitrophenoxy)-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl]acetamide |
|---|---|
| PubChem CID | 10805328 |
| Molecular Formula | C11H13N2O7P |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-[2-(4-nitrophenoxy)-2-oxo-1,3,2λ5-dioxaphosphinan-5-yl]acetamide |
| SMILES | CC(=O)NC1COP(=O)(Oc2ccc([N+](=O)[O-])cc2)OC1 |
| InChI | InChI=1S/C11H13N2O7P/c1-8(14)12-9-6-18-21(17,19-7-9)20-11-4-2-10(3-5-11)13(15)16/h2-5,9H,6-7H2,1H3,(H,12,14) |
| InChIKey | RNJBQFXJWNZBOL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|