C15H13Cl2NO3 — CID 10806018
methyl (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienoate (PubChem CID 10806018) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is methyl (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 10806018 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | methyl (2Z,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienoate |
| SMILES | COC(=O)/C(=C/C=C/c1cc2cc(Cl)c(Cl)cc2[nH]1)OC |
| InChI | InChI=1S/C15H13Cl2NO3/c1-20-14(15(19)21-2)5-3-4-10-6-9-7-11(16)12(17)8-13(9)18-10/h3-8,18H,1-2H3/b4-3+,14-5- |
| InChIKey | VUONTIGZNJVBHV-WLXMHCNISA-N |
| XLogP | 4.19 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|