C16H23BrO2 — CID 10806093
(1S,3S,4S)-3-(2-bromo-3-hydroxy-3-methylbutyl)-1,3-dimethyl-8-methylidenebicyclo[2.2.2]oct-5-en-2-one (PubChem CID 10806093) has the molecular formula C16H23BrO2 and a molecular weight of 327.26 g/mol. Its IUPAC name is (1S,3S,4S)-3-(2-bromo-3-hydroxy-3-methylbutyl)-1,3-dimethyl-8-methylidenebicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,3S,4S)-3-(2-bromo-3-hydroxy-3-methylbutyl)-1,3-dimethyl-8-methylidenebicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 10806093 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (1S,3S,4S)-3-(2-bromo-3-hydroxy-3-methylbutyl)-1,3-dimethyl-8-methylidenebicyclo[2.2.2]oct-5-en-2-one |
| SMILES | C=C1C[C@@]2(C)C=C[C@@H]1[C@](C)(CC(Br)C(C)(C)O)C2=O |
| InChI | InChI=1S/C16H23BrO2/c1-10-8-15(4)7-6-11(10)16(5,13(15)18)9-12(17)14(2,3)19/h6-7,11-12,19H,1,8-9H2,2-5H3/t11-,12?,15+,16-/m0/s1 |
| InChIKey | TWYSKPDOJMVZCK-KNJCGTFISA-N |
| XLogP | 3.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|