C22H21NO2 — CID 10806410
3-[4-(3-formyl-2-methylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-methylbenzaldehyde (PubChem CID 10806410) has the molecular formula C22H21NO2 and a molecular weight of 331.41 g/mol. Its IUPAC name is 3-[4-(3-formyl-2-methylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-methylbenzaldehyde.
| Compound Name | 3-[4-(3-formyl-2-methylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 10806410 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-[4-(3-formyl-2-methylphenyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-methylbenzaldehyde |
| SMILES | Cc1[nH]c(C)c(-c2cccc(C=O)c2C)c1-c1cccc(C=O)c1C |
| InChI | InChI=1S/C22H21NO2/c1-13-17(11-24)7-5-9-19(13)21-15(3)23-16(4)22(21)20-10-6-8-18(12-25)14(20)2/h5-12,23H,1-4H3 |
| InChIKey | UQBNESDUKZMPFP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|