About 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine
6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine (PubChem CID 10806691) has the molecular formula C15H12BrFN2O
and a molecular weight of 335.18 g/mol. Its IUPAC name is 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine.
Molecular Properties
| Compound Name | 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine |
| PubChem CID | 10806691 |
| Molecular Formula | C15H12BrFN2O |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine |
| SMILES | CC1(C)N=C(c2ccccn2)c2cc(Br)c(F)cc2O1 |
| InChI | InChI=1S/C15H12BrFN2O/c1-15(2)19-14(12-5-3-4-6-18-12)9-7-10(16)11(17)8-13(9)20-15/h3-8H,1-2H3 |
| InChIKey | PLTGBFIRKSSPJB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine?
The IUPAC name of 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine (CID 10806691) is 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine.
What is the SMILES notation for 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine?
The canonical SMILES for 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine is CC1(C)N=C(c2ccccn2)c2cc(Br)c(F)cc2O1.
What is the InChIKey of 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine?
The InChIKey is PLTGBFIRKSSPJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrFN2O/c1-15(2)19-14(12-5-3-4-6-18-12)9-7-10(16)11(17)8-13(9)20-15/h3-8H,1-2H3.
What are the key properties of 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine?
6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine has a molecular weight of 335.18 g/mol, XLogP of 3.95, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-fluoro-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine is sourced from PubChem (CID 10806691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).