C18H26O6 — CID 10806932
ethyl (1S,2R,5S,7S,8R)-2-methoxy-6-oxo-8-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]tricyclo[3.2.1.02,7]octane-1-carboxylate (PubChem CID 10806932) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is ethyl (1S,2R,5S,7S,8R)-2-methoxy-6-oxo-8-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]tricyclo[3.2.1.02,7]octane-1-carboxylate.
| Compound Name | ethyl (1S,2R,5S,7S,8R)-2-methoxy-6-oxo-8-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]tricyclo[3.2.1.02,7]octane-1-carboxylate |
|---|---|
| PubChem CID | 10806932 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | ethyl (1S,2R,5S,7S,8R)-2-methoxy-6-oxo-8-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]tricyclo[3.2.1.02,7]octane-1-carboxylate |
| SMILES | CCOC(=O)[C@]12[C@H]([C@@H]3OC(C)(C)O[C@H]3C)[C@@H]3CC[C@@]1(OC)[C@H]2C3=O |
| InChI | InChI=1S/C18H26O6/c1-6-22-15(20)18-11(13-9(2)23-16(3,4)24-13)10-7-8-17(18,21-5)14(18)12(10)19/h9-11,13-14H,6-8H2,1-5H3/t9-,10-,11-,13+,14+,17+,18+/m0/s1 |
| InChIKey | PDPZDUNZNMVOSS-HPQGPNDOSA-N |
| XLogP | 1.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |