C21H22O2S — CID 10806955
(2R,3R)-2-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]decan-4-one (PubChem CID 10806955) has the molecular formula C21H22O2S and a molecular weight of 338.47 g/mol. Its IUPAC name is (2R,3R)-2-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]decan-4-one.
| Compound Name | (2R,3R)-2-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 10806955 |
| Molecular Formula | C21H22O2S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (2R,3R)-2-phenyl-3-phenylsulfanyl-1-oxaspiro[4.5]decan-4-one |
| SMILES | O=C1[C@H](Sc2ccccc2)[C@@H](c2ccccc2)OC12CCCCC2 |
| InChI | InChI=1S/C21H22O2S/c22-20-19(24-17-12-6-2-7-13-17)18(16-10-4-1-5-11-16)23-21(20)14-8-3-9-15-21/h1-2,4-7,10-13,18-19H,3,8-9,14-15H2/t18-,19-/m1/s1 |
| InChIKey | WGPVMVDFWPYLLR-RTBURBONSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |