C22H26N2O2 — CID 10807795
7-[[4-(3,4-dimethylphenyl)piperidin-1-yl]methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 10807795) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 7-[[4-(3,4-dimethylphenyl)piperidin-1-yl]methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[[4-(3,4-dimethylphenyl)piperidin-1-yl]methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10807795 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 7-[[4-(3,4-dimethylphenyl)piperidin-1-yl]methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(C2CCN(Cc3ccc4c(c3)OCC(=O)N4)CC2)cc1C |
| InChI | InChI=1S/C22H26N2O2/c1-15-3-5-19(11-16(15)2)18-7-9-24(10-8-18)13-17-4-6-20-21(12-17)26-14-22(25)23-20/h3-6,11-12,18H,7-10,13-14H2,1-2H3,(H,23,25) |
| InChIKey | MEPWUVRGPZZAFY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |