C21H34O4 — CID 10807801
(E,1R)-4-ethyl-1-[(3S,5S,7S)-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]hex-4-en-1-ol (PubChem CID 10807801) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (E,1R)-4-ethyl-1-[(3S,5S,7S)-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]hex-4-en-1-ol.
| Compound Name | (E,1R)-4-ethyl-1-[(3S,5S,7S)-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]hex-4-en-1-ol |
|---|---|
| PubChem CID | 10807801 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (E,1R)-4-ethyl-1-[(3S,5S,7S)-3-methyl-4,6,8-trioxadispiro[4.1.57.35]pentadec-13-en-3-yl]hex-4-en-1-ol |
| SMILES | C/C=C(\CC)CC[C@@H](O)[C@]1(C)CC[C@]2(CC=C[C@]3(CCCCO3)O2)O1 |
| InChI | InChI=1S/C21H34O4/c1-4-17(5-2)9-10-18(22)19(3)14-15-21(24-19)13-8-12-20(25-21)11-6-7-16-23-20/h4,8,12,18,22H,5-7,9-11,13-16H2,1-3H3/b17-4+/t18-,19+,20+,21-/m1/s1 |
| InChIKey | GBJDZONTTRYYMB-GWXAGXPHSA-N |
| XLogP | 4.62 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|