C15H26O5S2 — CID 10807802
(3aR,4R,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6-bis(methylsulfanyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran (PubChem CID 10807802) has the molecular formula C15H26O5S2 and a molecular weight of 350.50 g/mol. Its IUPAC name is (3aR,4R,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6-bis(methylsulfanyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aR,4R,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6-bis(methylsulfanyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 10807802 |
| Molecular Formula | C15H26O5S2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (3aR,4R,7aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6-bis(methylsulfanyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CSC1(SC)C[C@H]2OC(C)(C)O[C@H]2[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C15H26O5S2/c1-13(2)16-8-10(18-13)12-11-9(17-14(3,4)19-11)7-15(20-12,21-5)22-6/h9-12H,7-8H2,1-6H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | SOJNGNZERUGHRZ-DDHJBXDOSA-N |
| XLogP | 2.83 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|