C21H38O2Si — CID 10807820
(1S,4R,5R,7S,11R)-11-butyl-4-[tert-butyl(dimethyl)silyl]oxytricyclo[5.3.1.01,5]undecan-6-one (PubChem CID 10807820) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is (1S,4R,5R,7S,11R)-11-butyl-4-[tert-butyl(dimethyl)silyl]oxytricyclo[5.3.1.01,5]undecan-6-one.
| Compound Name | (1S,4R,5R,7S,11R)-11-butyl-4-[tert-butyl(dimethyl)silyl]oxytricyclo[5.3.1.01,5]undecan-6-one |
|---|---|
| PubChem CID | 10807820 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (1S,4R,5R,7S,11R)-11-butyl-4-[tert-butyl(dimethyl)silyl]oxytricyclo[5.3.1.01,5]undecan-6-one |
| SMILES | CCCC[C@@H]1[C@@H]2CCC[C@]13CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3C2=O |
| InChI | InChI=1S/C21H38O2Si/c1-7-8-11-16-15-10-9-13-21(16)14-12-17(18(21)19(15)22)23-24(5,6)20(2,3)4/h15-18H,7-14H2,1-6H3/t15-,16+,17+,18+,21-/m0/s1 |
| InChIKey | BJNAIQOJNJKHQX-CXBOPNHVSA-N |
| XLogP | 5.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|