C19H23N5O2 — CID 10807987
9-benzyl-2-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1,8-dimethylpurin-6-one (PubChem CID 10807987) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 9-benzyl-2-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1,8-dimethylpurin-6-one.
| Compound Name | 9-benzyl-2-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1,8-dimethylpurin-6-one |
|---|---|
| PubChem CID | 10807987 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 9-benzyl-2-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1,8-dimethylpurin-6-one |
| SMILES | Cc1nc2c(=O)n(C)c(N[C@@H]3CCC[C@H]3O)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C19H23N5O2/c1-12-20-16-17(24(12)11-13-7-4-3-5-8-13)22-19(23(2)18(16)26)21-14-9-6-10-15(14)25/h3-5,7-8,14-15,25H,6,9-11H2,1-2H3,(H,21,22)/t14-,15-/m1/s1 |
| InChIKey | DBOZQDMIBCKWTO-HUUCEWRRSA-N |
| XLogP | 1.81 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |