C24H36O2 — CID 10808214
1,5-dimethoxy-3-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene (PubChem CID 10808214) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is 1,5-dimethoxy-3-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene.
| Compound Name | 1,5-dimethoxy-3-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene |
|---|---|
| PubChem CID | 10808214 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 1,5-dimethoxy-3-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene |
| SMILES | COc1cc(C)c(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H36O2/c1-18(2)10-8-11-19(3)12-9-13-20(4)14-15-23-21(5)16-22(25-6)17-24(23)26-7/h10,12,14,16-17H,8-9,11,13,15H2,1-7H3/b19-12+,20-14+ |
| InChIKey | CDVBDSFNLFHWSH-LCAIAVFMSA-N |
| XLogP | 6.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|