C19H15F3N2O2 — CID 10808452
(3E,5E)-1,1,1-trifluoro-N-(4-methylphenyl)-6-(4-nitrophenyl)hexa-3,5-dien-2-imine (PubChem CID 10808452) has the molecular formula C19H15F3N2O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is (3E,5E)-1,1,1-trifluoro-N-(4-methylphenyl)-6-(4-nitrophenyl)hexa-3,5-dien-2-imine.
| Compound Name | (3E,5E)-1,1,1-trifluoro-N-(4-methylphenyl)-6-(4-nitrophenyl)hexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 10808452 |
| Molecular Formula | C19H15F3N2O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (3E,5E)-1,1,1-trifluoro-N-(4-methylphenyl)-6-(4-nitrophenyl)hexa-3,5-dien-2-imine |
| SMILES | Cc1ccc(/N=C(/C=C/C=C/c2ccc([N+](=O)[O-])cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N2O2/c1-14-6-10-16(11-7-14)23-18(19(20,21)22)5-3-2-4-15-8-12-17(13-9-15)24(25)26/h2-13H,1H3/b4-2+,5-3+,23-18- |
| InChIKey | CXVSAMLWOBTBML-AWPRGOQYSA-N |
| XLogP | 5.81 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|