About 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid
5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid (PubChem CID 10808456) has the molecular formula C14H12N6O4S
and a molecular weight of 360.36 g/mol. Its IUPAC name is 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid |
| PubChem CID | 10808456 |
| Molecular Formula | C14H12N6O4S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid |
| SMILES | Nc1nc(N)c2nc(CC(C(=O)O)c3ccc(C(=O)O)s3)cnc2n1 |
| InChI | InChI=1S/C14H12N6O4S/c15-10-9-11(20-14(16)19-10)17-4-5(18-9)3-6(12(21)22)7-1-2-8(25-7)13(23)24/h1-2,4,6H,3H2,(H,21,22)(H,23,24)(H4,15,16,17,19,20) |
| InChIKey | XDZLOUHHOKDTQN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 178.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid (CID 10808456) is 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid is Nc1nc(N)c2nc(CC(C(=O)O)c3ccc(C(=O)O)s3)cnc2n1.
What is the InChIKey of 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid?
The InChIKey is XDZLOUHHOKDTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N6O4S/c15-10-9-11(20-14(16)19-10)17-4-5(18-9)3-6(12(21)22)7-1-2-8(25-7)13(23)24/h1-2,4,6H,3H2,(H,21,22)(H,23,24)(H4,15,16,17,19,20).
What are the key properties of 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid?
5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid has a molecular weight of 360.36 g/mol, XLogP of 0.75, 5 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-carboxy-2-(2,4-diaminopteridin-6-yl)ethyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 10808456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).