C24H24OS — CID 10808507
S-[2,6-bis(2,6-dimethylphenyl)phenyl] ethanethioate (PubChem CID 10808507) has the molecular formula C24H24OS and a molecular weight of 360.52 g/mol. Its IUPAC name is S-[2,6-bis(2,6-dimethylphenyl)phenyl] ethanethioate.
| Compound Name | S-[2,6-bis(2,6-dimethylphenyl)phenyl] ethanethioate |
|---|---|
| PubChem CID | 10808507 |
| Molecular Formula | C24H24OS |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | S-[2,6-bis(2,6-dimethylphenyl)phenyl] ethanethioate |
| SMILES | CC(=O)Sc1c(-c2c(C)cccc2C)cccc1-c1c(C)cccc1C |
| InChI | InChI=1S/C24H24OS/c1-15-9-6-10-16(2)22(15)20-13-8-14-21(24(20)26-19(5)25)23-17(3)11-7-12-18(23)4/h6-14H,1-5H3 |
| InChIKey | TVQSLIIMIZQTNO-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|