About 1-bromo-3,7,11,15-tetramethylhexadecane
1-bromo-3,7,11,15-tetramethylhexadecane (PubChem CID 10808570) has the molecular formula C20H41Br
and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-bromo-3,7,11,15-tetramethylhexadecane.
Molecular Properties
| Compound Name | 1-bromo-3,7,11,15-tetramethylhexadecane |
| PubChem CID | 10808570 |
| Molecular Formula | C20H41Br |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 1-bromo-3,7,11,15-tetramethylhexadecane |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCBr |
| InChI | InChI=1S/C20H41Br/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h17-20H,6-16H2,1-5H3 |
| InChIKey | DNKBEUKCVDMKFH-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,7,11,15-tetramethylhexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,7,11,15-tetramethylhexadecane?
The IUPAC name of 1-bromo-3,7,11,15-tetramethylhexadecane (CID 10808570) is 1-bromo-3,7,11,15-tetramethylhexadecane.
What is the SMILES notation for 1-bromo-3,7,11,15-tetramethylhexadecane?
The canonical SMILES for 1-bromo-3,7,11,15-tetramethylhexadecane is CC(C)CCCC(C)CCCC(C)CCCC(C)CCBr.
What is the InChIKey of 1-bromo-3,7,11,15-tetramethylhexadecane?
The InChIKey is DNKBEUKCVDMKFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41Br/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h17-20H,6-16H2,1-5H3.
What are the key properties of 1-bromo-3,7,11,15-tetramethylhexadecane?
1-bromo-3,7,11,15-tetramethylhexadecane has a molecular weight of 361.45 g/mol, XLogP of 7.85, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,7,11,15-tetramethylhexadecane is sourced from PubChem (CID 10808570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).