C20H33NO3Si — CID 10808725
(4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5,5-tetramethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile (PubChem CID 10808725) has the molecular formula C20H33NO3Si and a molecular weight of 363.57 g/mol. Its IUPAC name is (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5,5-tetramethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile.
| Compound Name | (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5,5-tetramethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile |
|---|---|
| PubChem CID | 10808725 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5,5-tetramethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carbonitrile |
| SMILES | CC1(C)CC(=O)[C@]2(C#N)[C@@H](CC(O[Si](C)(C)C(C)(C)C)=CC2(C)C)O1 |
| InChI | InChI=1S/C20H33NO3Si/c1-17(2,3)25(8,9)24-14-10-16-20(13-21,18(4,5)11-14)15(22)12-19(6,7)23-16/h11,16H,10,12H2,1-9H3/t16-,20-/m1/s1 |
| InChIKey | WKDLDLFXNZQIMH-OXQOHEQNSA-N |
| XLogP | 4.97 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|