C22H23NO4 — CID 10808830
(1S,2S,4R,8S,9S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-one (PubChem CID 10808830) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (1S,2S,4R,8S,9S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-one.
| Compound Name | (1S,2S,4R,8S,9S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-one |
|---|---|
| PubChem CID | 10808830 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (1S,2S,4R,8S,9S)-8-phenylmethoxy-9-(phenylmethoxymethyl)-3-oxa-6-azatricyclo[4.3.0.02,4]nonan-7-one |
| SMILES | O=C1[C@@H](OCc2ccccc2)[C@H](COCc2ccccc2)[C@H]2[C@@H]3O[C@@H]3CN12 |
| InChI | InChI=1S/C22H23NO4/c24-22-20(26-13-16-9-5-2-6-10-16)17(19-21-18(27-21)11-23(19)22)14-25-12-15-7-3-1-4-8-15/h1-10,17-21H,11-14H2/t17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | NANKLNVMRYCAJE-CRSSMBPESA-N |
| XLogP | 2.40 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|