About disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate
disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate (PubChem CID 10809) has the molecular formula C7H8AsNNa2O6S
and a molecular weight of 355.11 g/mol. Its IUPAC name is disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate.
Molecular Properties
| Compound Name | disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate |
| PubChem CID | 10809 |
| Molecular Formula | C7H8AsNNa2O6S |
| Molecular Weight | 355.11 g/mol |
| Exact Mass | 354.91 |
| IUPAC Name | disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate |
| SMILES | O=S([O-])CNc1cc([As](=O)([O-])O)ccc1O.[Na+].[Na+] |
| InChI | InChI=1S/C7H10AsNO6S.2Na/c10-7-2-1-5(8(11,12)13)3-6(7)9-4-16(14)15;;/h1-3,9-10H,4H2,(H,14,15)(H2,11,12,13);;/q;2*+1/p-2 |
| InChIKey | DXOVFKCXTQMPEM-UHFFFAOYSA-L |
| XLogP | -8.42 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.11 |
| LogP ≤ 5 | -8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate?
The IUPAC name of disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate (CID 10809) is disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate.
What is the SMILES notation for disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate?
The canonical SMILES for disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate is O=S([O-])CNc1cc([As](=O)([O-])O)ccc1O.[Na+].[Na+].
What is the InChIKey of disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate?
The InChIKey is DXOVFKCXTQMPEM-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H10AsNO6S.2Na/c10-7-2-1-5(8(11,12)13)3-6(7)9-4-16(14)15;;/h1-3,9-10H,4H2,(H,14,15)(H2,11,12,13);;/q;2*+1/p-2.
What are the key properties of disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate?
disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate has a molecular weight of 355.11 g/mol, XLogP of -8.42, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[2-hydroxy-5-[hydroxy(oxido)arsoryl]anilino]methanesulfinate is sourced from PubChem (CID 10809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).