C16H20ClN3O5 — CID 10809137
(2R,3S,4R,5S,6E)-6-[(6-chloro-4-methylquinolin-2-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol (PubChem CID 10809137) has the molecular formula C16H20ClN3O5 and a molecular weight of 369.81 g/mol. Its IUPAC name is (2R,3S,4R,5S,6E)-6-[(6-chloro-4-methylquinolin-2-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4R,5S,6E)-6-[(6-chloro-4-methylquinolin-2-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 10809137 |
| Molecular Formula | C16H20ClN3O5 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2R,3S,4R,5S,6E)-6-[(6-chloro-4-methylquinolin-2-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol |
| SMILES | Cc1cc(N/N=C/[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H20ClN3O5/c1-8-4-14(19-11-3-2-9(17)5-10(8)11)20-18-6-12(22)15(24)16(25)13(23)7-21/h2-6,12-13,15-16,21-25H,7H2,1H3,(H,19,20)/b18-6+/t12-,13+,15+,16-/m0/s1 |
| InChIKey | GCEZXEJHWDXOSA-FBHLTALHSA-N |
| XLogP | 0.03 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|