C21H38O5 — CID 10809191
(2R)-2-ethyl-4-[(2S,3S,6R,8S,9S,10R,11R)-10-hydroxy-2-[(2R)-2-hydroxypropyl]-3,9,11-trimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]butanal (PubChem CID 10809191) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is (2R)-2-ethyl-4-[(2S,3S,6R,8S,9S,10R,11R)-10-hydroxy-2-[(2R)-2-hydroxypropyl]-3,9,11-trimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]butanal.
| Compound Name | (2R)-2-ethyl-4-[(2S,3S,6R,8S,9S,10R,11R)-10-hydroxy-2-[(2R)-2-hydroxypropyl]-3,9,11-trimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]butanal |
|---|---|
| PubChem CID | 10809191 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (2R)-2-ethyl-4-[(2S,3S,6R,8S,9S,10R,11R)-10-hydroxy-2-[(2R)-2-hydroxypropyl]-3,9,11-trimethyl-1,7-dioxaspiro[5.5]undecan-8-yl]butanal |
| SMILES | CC[C@@H](C=O)CC[C@@H]1O[C@]2(CC[C@H](C)[C@H](C[C@@H](C)O)O2)[C@H](C)[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C21H38O5/c1-6-17(12-22)7-8-18-15(4)20(24)16(5)21(25-18)10-9-13(2)19(26-21)11-14(3)23/h12-20,23-24H,6-11H2,1-5H3/t13-,14+,15+,16+,17+,18-,19-,20+,21-/m0/s1 |
| InChIKey | YDSBKNQBXGIPSC-ZARWHTSASA-N |
| XLogP | 3.31 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|