About dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate
dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate (PubChem CID 10809271) has the molecular formula C14H16N2O8S
and a molecular weight of 372.36 g/mol. Its IUPAC name is dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate |
| PubChem CID | 10809271 |
| Molecular Formula | C14H16N2O8S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1CC[C@H](C(=O)OC)N1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H16N2O8S/c1-23-13(17)11-7-8-12(14(18)24-2)15(11)25(21,22)10-5-3-9(4-6-10)16(19)20/h3-6,11-12H,7-8H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | RDSYKFLXXQATGQ-VXGBXAGGSA-N |
| XLogP | 0.46 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate?
The IUPAC name of dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate (CID 10809271) is dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate.
What is the SMILES notation for dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate?
The canonical SMILES for dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate is COC(=O)[C@H]1CC[C@H](C(=O)OC)N1S(=O)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate?
The InChIKey is RDSYKFLXXQATGQ-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H16N2O8S/c1-23-13(17)11-7-8-12(14(18)24-2)15(11)25(21,22)10-5-3-9(4-6-10)16(19)20/h3-6,11-12H,7-8H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate?
dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate has a molecular weight of 372.36 g/mol, XLogP of 0.46, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2R,5R)-1-(4-nitrophenyl)sulfonylpyrrolidine-2,5-dicarboxylate is sourced from PubChem (CID 10809271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).