C16H15F3N2O3S — CID 10809275
9-methyl-2-aza-9-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;trifluoromethanesulfonate (PubChem CID 10809275) has the molecular formula C16H15F3N2O3S and a molecular weight of 372.37 g/mol. Its IUPAC name is 9-methyl-2-aza-9-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;trifluoromethanesulfonate.
| Compound Name | 9-methyl-2-aza-9-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10809275 |
| Molecular Formula | C16H15F3N2O3S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 9-methyl-2-aza-9-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,9,12-hexaene;trifluoromethanesulfonate |
| SMILES | C[N+]1=CC2C=CC=C3N=CC4=CC=CC1C4C32.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H15N2.CHF3O3S/c1-17-9-11-5-2-6-12-14(11)15-10(8-16-12)4-3-7-13(15)17;2-1(3,4)8(5,6)7/h2-9,11,13-15H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | VXYCKSBJHXQMAV-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|