C23H32O4 — CID 10809308
(1R,4S,5R,8S,12R,13S)-5-methyl-1-(4-phenylbutyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10809308) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1R,4S,5R,8S,12R,13S)-5-methyl-1-(4-phenylbutyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8S,12R,13S)-5-methyl-1-(4-phenylbutyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10809308 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1R,4S,5R,8S,12R,13S)-5-methyl-1-(4-phenylbutyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CC[C@H]2CCO[C@@H]3O[C@@]4(CCCCc5ccccc5)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C23H32O4/c1-17-10-11-19-13-16-24-21-23(19)20(17)12-15-22(25-21,26-27-23)14-6-5-9-18-7-3-2-4-8-18/h2-4,7-8,17,19-21H,5-6,9-16H2,1H3/t17-,19+,20+,21-,22-,23+/m1/s1 |
| InChIKey | KQRWFKXRJIUUEU-ARQYYYJSSA-N |
| XLogP | 5.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|