C19H17ClN2O4 — CID 10809326
(2S,3R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-2-hydroxy-4-phenylbutanoic acid (PubChem CID 10809326) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is (2S,3R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-2-hydroxy-4-phenylbutanoic acid.
| Compound Name | (2S,3R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-2-hydroxy-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 10809326 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (2S,3R)-3-[(5-chloro-1H-indole-2-carbonyl)amino]-2-hydroxy-4-phenylbutanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)[C@H](O)C(=O)O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C19H17ClN2O4/c20-13-6-7-14-12(9-13)10-16(21-14)18(24)22-15(17(23)19(25)26)8-11-4-2-1-3-5-11/h1-7,9-10,15,17,21,23H,8H2,(H,22,24)(H,25,26)/t15-,17+/m1/s1 |
| InChIKey | FFEPTJHAPRPKOB-WBVHZDCISA-N |
| XLogP | 2.61 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |