C21H29NO5 — CID 10809478
(2S,3S,4S)-3-(carboxymethyl)-4-[1-(3-methyl-4-pentoxyphenyl)ethenyl]pyrrolidine-2-carboxylic acid (PubChem CID 10809478) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S,3S,4S)-3-(carboxymethyl)-4-[1-(3-methyl-4-pentoxyphenyl)ethenyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S)-3-(carboxymethyl)-4-[1-(3-methyl-4-pentoxyphenyl)ethenyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10809478 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (2S,3S,4S)-3-(carboxymethyl)-4-[1-(3-methyl-4-pentoxyphenyl)ethenyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=C(c1ccc(OCCCCC)c(C)c1)[C@H]1CN[C@H](C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C21H29NO5/c1-4-5-6-9-27-18-8-7-15(10-13(18)2)14(3)17-12-22-20(21(25)26)16(17)11-19(23)24/h7-8,10,16-17,20,22H,3-6,9,11-12H2,1-2H3,(H,23,24)(H,25,26)/t16-,17+,20-/m0/s1 |
| InChIKey | HZWJRQHKZPBREB-QKLQHJQFSA-N |
| XLogP | 3.34 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|