C22H24N4S — CID 10809561
8-(4-benzylpiperazin-1-yl)-4,5-dimethyl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 10809561) has the molecular formula C22H24N4S and a molecular weight of 376.53 g/mol. Its IUPAC name is 8-(4-benzylpiperazin-1-yl)-4,5-dimethyl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 8-(4-benzylpiperazin-1-yl)-4,5-dimethyl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 10809561 |
| Molecular Formula | C22H24N4S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 8-(4-benzylpiperazin-1-yl)-4,5-dimethyl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | Cc1sc2c(nc(N3CCN(Cc4ccccc4)CC3)c3cccn32)c1C |
| InChI | InChI=1S/C22H24N4S/c1-16-17(2)27-22-20(16)23-21(19-9-6-10-26(19)22)25-13-11-24(12-14-25)15-18-7-4-3-5-8-18/h3-10H,11-15H2,1-2H3 |
| InChIKey | BKNVUCYNQODGLA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |