About 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide
5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide (PubChem CID 10809613) has the molecular formula C14H17F2NO3S2Si
and a molecular weight of 377.51 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide.
Molecular Properties
| Compound Name | 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide |
| PubChem CID | 10809613 |
| Molecular Formula | C14H17F2NO3S2Si |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide |
| SMILES | C[Si](C)(C)OC(c1cc(F)cc(F)c1)c1cc(S(N)(=O)=O)cs1 |
| InChI | InChI=1S/C14H17F2NO3S2Si/c1-23(2,3)20-14(9-4-10(15)6-11(16)5-9)13-7-12(8-21-13)22(17,18)19/h4-8,14H,1-3H3,(H2,17,18,19) |
| InChIKey | UBSAIPFKQZAIER-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide?
The IUPAC name of 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide (CID 10809613) is 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide.
What is the SMILES notation for 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide?
The canonical SMILES for 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide is C[Si](C)(C)OC(c1cc(F)cc(F)c1)c1cc(S(N)(=O)=O)cs1.
What is the InChIKey of 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide?
The InChIKey is UBSAIPFKQZAIER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO3S2Si/c1-23(2,3)20-14(9-4-10(15)6-11(16)5-9)13-7-12(8-21-13)22(17,18)19/h4-8,14H,1-3H3,(H2,17,18,19).
What are the key properties of 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide?
5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide has a molecular weight of 377.51 g/mol, XLogP of 3.61, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-difluorophenyl)-trimethylsilyloxymethyl]thiophene-3-sulfonamide is sourced from PubChem (CID 10809613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).