C24H30N2O2 — CID 10809681
N,N-bis(2-methylpropyl)-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzamide (PubChem CID 10809681) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzamide.
| Compound Name | N,N-bis(2-methylpropyl)-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 10809681 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N,N-bis(2-methylpropyl)-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1ccc(-c2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-16(2)14-26(15-17(3)4)24(28)19-7-5-18(6-8-19)20-9-11-22-21(13-20)10-12-23(27)25-22/h5-9,11,13,16-17H,10,12,14-15H2,1-4H3,(H,25,27) |
| InChIKey | IRDSYOUYDXCLRW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |