C19H18F3NO4 — CID 10809847
7,8-dimethoxy-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one (PubChem CID 10809847) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is 7,8-dimethoxy-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one.
| Compound Name | 7,8-dimethoxy-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one |
|---|---|
| PubChem CID | 10809847 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 7,8-dimethoxy-2-(2,2,2-trifluoroacetyl)spiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohexa-2,5-diene]-1'-one |
| SMILES | COc1cc2c(cc1OC)C1(C=CC(=O)C=C1)CCN(C(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C19H18F3NO4/c1-26-15-9-12-11-23(17(25)19(20,21)22)8-7-18(5-3-13(24)4-6-18)14(12)10-16(15)27-2/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | YRRMDYKPSXONRG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |